C24H31N3O7S2 — CID 43875203
3-(4-morpholin-4-ylsulfonylphenyl)-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]propanamide (PubChem CID 43875203) has the molecular formula C24H31N3O7S2 and a molecular weight of 537.66 g/mol. Its IUPAC name is 3-(4-morpholin-4-ylsulfonylphenyl)-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]propanamide.
| Compound Name | 3-(4-morpholin-4-ylsulfonylphenyl)-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 43875203 |
| Molecular Formula | C24H31N3O7S2 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | 3-(4-morpholin-4-ylsulfonylphenyl)-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]propanamide |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCOCC2)cc1)NCc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H31N3O7S2/c28-24(10-5-20-1-6-22(7-2-20)35(29,30)26-11-15-33-16-12-26)25-19-21-3-8-23(9-4-21)36(31,32)27-13-17-34-18-14-27/h1-4,6-9H,5,10-19H2,(H,25,28) |
| InChIKey | ZXJOYQHCKWOIMY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |