C23H30N2O7S — CID 55806613
3-(4-morpholin-4-ylsulfonylphenyl)-N-[(2,4,6-trimethoxyphenyl)methyl]propanamide (PubChem CID 55806613) has the molecular formula C23H30N2O7S and a molecular weight of 478.57 g/mol. Its IUPAC name is 3-(4-morpholin-4-ylsulfonylphenyl)-N-[(2,4,6-trimethoxyphenyl)methyl]propanamide.
| Compound Name | 3-(4-morpholin-4-ylsulfonylphenyl)-N-[(2,4,6-trimethoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 55806613 |
| Molecular Formula | C23H30N2O7S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 3-(4-morpholin-4-ylsulfonylphenyl)-N-[(2,4,6-trimethoxyphenyl)methyl]propanamide |
| SMILES | COc1cc(OC)c(CNC(=O)CCc2ccc(S(=O)(=O)N3CCOCC3)cc2)c(OC)c1 |
| InChI | InChI=1S/C23H30N2O7S/c1-29-18-14-21(30-2)20(22(15-18)31-3)16-24-23(26)9-6-17-4-7-19(8-5-17)33(27,28)25-10-12-32-13-11-25/h4-5,7-8,14-15H,6,9-13,16H2,1-3H3,(H,24,26) |
| InChIKey | KAZSDMFOBPLSOD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |