C23H29N3O6S — CID 42995329
N-[(E)-1-(3,4-dimethoxyphenyl)ethylideneamino]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide (PubChem CID 42995329) has the molecular formula C23H29N3O6S and a molecular weight of 475.57 g/mol. Its IUPAC name is N-[(E)-1-(3,4-dimethoxyphenyl)ethylideneamino]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide.
| Compound Name | N-[(E)-1-(3,4-dimethoxyphenyl)ethylideneamino]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 42995329 |
| Molecular Formula | C23H29N3O6S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | N-[(E)-1-(3,4-dimethoxyphenyl)ethylideneamino]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide |
| SMILES | COc1ccc(/C(C)=N/NC(=O)CCc2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1OC |
| InChI | InChI=1S/C23H29N3O6S/c1-17(19-7-10-21(30-2)22(16-19)31-3)24-25-23(27)11-6-18-4-8-20(9-5-18)33(28,29)26-12-14-32-15-13-26/h4-5,7-10,16H,6,11-15H2,1-3H3,(H,25,27)/b24-17+ |
| InChIKey | MQQATULBPSRTEX-JJIBRWJFSA-N |
| XLogP | 2.20 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|