C20H23NO7S — CID 9331575
1-(3,4-dimethoxyphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone (PubChem CID 9331575) has the molecular formula C20H23NO7S and a molecular weight of 421.47 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone |
|---|---|
| PubChem CID | 9331575 |
| Molecular Formula | C20H23NO7S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone |
| SMILES | COc1ccc(C(=O)COc2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1OC |
| InChI | InChI=1S/C20H23NO7S/c1-25-19-8-3-15(13-20(19)26-2)18(22)14-28-16-4-6-17(7-5-16)29(23,24)21-9-11-27-12-10-21/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | KYOKCODVTDRLOM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |