C22H27NO5S — CID 9332581
1-(2,5-diethylphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone (PubChem CID 9332581) has the molecular formula C22H27NO5S and a molecular weight of 417.53 g/mol. Its IUPAC name is 1-(2,5-diethylphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone.
| Compound Name | 1-(2,5-diethylphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone |
|---|---|
| PubChem CID | 9332581 |
| Molecular Formula | C22H27NO5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 1-(2,5-diethylphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone |
| SMILES | CCc1ccc(CC)c(C(=O)COc2ccc(S(=O)(=O)N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C22H27NO5S/c1-3-17-5-6-18(4-2)21(15-17)22(24)16-28-19-7-9-20(10-8-19)29(25,26)23-11-13-27-14-12-23/h5-10,15H,3-4,11-14,16H2,1-2H3 |
| InChIKey | WQSMVBTWANMHJR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |