C18H28N3O5S+ — CID 7741281
1-(4-ethylpiperazin-4-ium-1-yl)-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone (PubChem CID 7741281) has the molecular formula C18H28N3O5S+ and a molecular weight of 398.51 g/mol. Its IUPAC name is 1-(4-ethylpiperazin-4-ium-1-yl)-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone.
| Compound Name | 1-(4-ethylpiperazin-4-ium-1-yl)-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone |
|---|---|
| PubChem CID | 7741281 |
| Molecular Formula | C18H28N3O5S+ |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 1-(4-ethylpiperazin-4-ium-1-yl)-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone |
| SMILES | CC[NH+]1CCN(C(=O)COc2ccc(S(=O)(=O)N3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C18H27N3O5S/c1-2-19-7-9-20(10-8-19)18(22)15-26-16-3-5-17(6-4-16)27(23,24)21-11-13-25-14-12-21/h3-6H,2,7-15H2,1H3/p+1 |
| InChIKey | HHGGKVIEMGRJTM-UHFFFAOYSA-O |
| XLogP | -1.17 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |