C24H31N3O5S — CID 55578358
1-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone (PubChem CID 55578358) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is 1-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone.
| Compound Name | 1-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone |
|---|---|
| PubChem CID | 55578358 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 1-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone |
| SMILES | Cc1cccc(CN2CCN(C(=O)COc3ccc(S(=O)(=O)N4CCOCC4)cc3)CC2)c1 |
| InChI | InChI=1S/C24H31N3O5S/c1-20-3-2-4-21(17-20)18-25-9-11-26(12-10-25)24(28)19-32-22-5-7-23(8-6-22)33(29,30)27-13-15-31-16-14-27/h2-8,17H,9-16,18-19H2,1H3 |
| InChIKey | PDYRJRJPLKCJBZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |