C21H32N4O5S — CID 30961426
1-morpholin-4-yl-2-[4-[(3-morpholin-4-ylsulfonylphenyl)methyl]piperazin-1-yl]ethanone (PubChem CID 30961426) has the molecular formula C21H32N4O5S and a molecular weight of 452.58 g/mol. Its IUPAC name is 1-morpholin-4-yl-2-[4-[(3-morpholin-4-ylsulfonylphenyl)methyl]piperazin-1-yl]ethanone.
| Compound Name | 1-morpholin-4-yl-2-[4-[(3-morpholin-4-ylsulfonylphenyl)methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 30961426 |
| Molecular Formula | C21H32N4O5S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 1-morpholin-4-yl-2-[4-[(3-morpholin-4-ylsulfonylphenyl)methyl]piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(Cc2cccc(S(=O)(=O)N3CCOCC3)c2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C21H32N4O5S/c26-21(24-8-12-29-13-9-24)18-23-6-4-22(5-7-23)17-19-2-1-3-20(16-19)31(27,28)25-10-14-30-15-11-25/h1-3,16H,4-15,17-18H2 |
| InChIKey | HNQBAPPFVUVGJK-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 82.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |