C16H24N2O3S — CID 169307366
4-[3-[(3,3-dimethylazetidin-1-yl)methyl]phenyl]sulfonylmorpholine (PubChem CID 169307366) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is 4-[3-[(3,3-dimethylazetidin-1-yl)methyl]phenyl]sulfonylmorpholine.
| Compound Name | 4-[3-[(3,3-dimethylazetidin-1-yl)methyl]phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 169307366 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 4-[3-[(3,3-dimethylazetidin-1-yl)methyl]phenyl]sulfonylmorpholine |
| SMILES | CC1(C)CN(Cc2cccc(S(=O)(=O)N3CCOCC3)c2)C1 |
| InChI | InChI=1S/C16H24N2O3S/c1-16(2)12-17(13-16)11-14-4-3-5-15(10-14)22(19,20)18-6-8-21-9-7-18/h3-5,10H,6-9,11-13H2,1-2H3 |
| InChIKey | HKRPETQMDBGSAH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |