C17H26N2O4S — CID 42955058
2,5-dimethyl-4-[(3-morpholin-4-ylsulfonylphenyl)methyl]morpholine (PubChem CID 42955058) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is 2,5-dimethyl-4-[(3-morpholin-4-ylsulfonylphenyl)methyl]morpholine.
| Compound Name | 2,5-dimethyl-4-[(3-morpholin-4-ylsulfonylphenyl)methyl]morpholine |
|---|---|
| PubChem CID | 42955058 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2,5-dimethyl-4-[(3-morpholin-4-ylsulfonylphenyl)methyl]morpholine |
| SMILES | CC1CN(Cc2cccc(S(=O)(=O)N3CCOCC3)c2)C(C)CO1 |
| InChI | InChI=1S/C17H26N2O4S/c1-14-13-23-15(2)11-18(14)12-16-4-3-5-17(10-16)24(20,21)19-6-8-22-9-7-19/h3-5,10,14-15H,6-9,11-13H2,1-2H3 |
| InChIKey | ONXCXECPNDWRIC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |