C24H32N2O4S — CID 25482649
4-[3-[[(2R)-2-(4-methoxyphenyl)azepan-1-yl]methyl]phenyl]sulfonylmorpholine (PubChem CID 25482649) has the molecular formula C24H32N2O4S and a molecular weight of 444.60 g/mol. Its IUPAC name is 4-[3-[[(2R)-2-(4-methoxyphenyl)azepan-1-yl]methyl]phenyl]sulfonylmorpholine.
| Compound Name | 4-[3-[[(2R)-2-(4-methoxyphenyl)azepan-1-yl]methyl]phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 25482649 |
| Molecular Formula | C24H32N2O4S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 4-[3-[[(2R)-2-(4-methoxyphenyl)azepan-1-yl]methyl]phenyl]sulfonylmorpholine |
| SMILES | COc1ccc([C@H]2CCCCCN2Cc2cccc(S(=O)(=O)N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C24H32N2O4S/c1-29-22-11-9-21(10-12-22)24-8-3-2-4-13-25(24)19-20-6-5-7-23(18-20)31(27,28)26-14-16-30-17-15-26/h5-7,9-12,18,24H,2-4,8,13-17,19H2,1H3/t24-/m1/s1 |
| InChIKey | GWMZYLIVAVXMJO-XMMPIXPASA-N |
| XLogP | 3.83 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |