C21H25F2NO3S — CID 112803307
1-[[4-(difluoromethylsulfonyl)phenyl]methyl]-2-(4-methoxyphenyl)azepane (PubChem CID 112803307) has the molecular formula C21H25F2NO3S and a molecular weight of 409.50 g/mol. Its IUPAC name is 1-[[4-(difluoromethylsulfonyl)phenyl]methyl]-2-(4-methoxyphenyl)azepane.
| Compound Name | 1-[[4-(difluoromethylsulfonyl)phenyl]methyl]-2-(4-methoxyphenyl)azepane |
|---|---|
| PubChem CID | 112803307 |
| Molecular Formula | C21H25F2NO3S |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 1-[[4-(difluoromethylsulfonyl)phenyl]methyl]-2-(4-methoxyphenyl)azepane |
| SMILES | COc1ccc(C2CCCCCN2Cc2ccc(S(=O)(=O)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H25F2NO3S/c1-27-18-10-8-17(9-11-18)20-5-3-2-4-14-24(20)15-16-6-12-19(13-7-16)28(25,26)21(22)23/h6-13,20-21H,2-5,14-15H2,1H3 |
| InChIKey | RGRADXDVXBNLCA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |