C18H22N2O — CID 872941
3-[(2S)-1-[(4-methoxyphenyl)methyl]piperidin-2-yl]pyridine (PubChem CID 872941) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 3-[(2S)-1-[(4-methoxyphenyl)methyl]piperidin-2-yl]pyridine.
| Compound Name | 3-[(2S)-1-[(4-methoxyphenyl)methyl]piperidin-2-yl]pyridine |
|---|---|
| PubChem CID | 872941 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 3-[(2S)-1-[(4-methoxyphenyl)methyl]piperidin-2-yl]pyridine |
| SMILES | COc1ccc(CN2CCCC[C@H]2c2cccnc2)cc1 |
| InChI | InChI=1S/C18H22N2O/c1-21-17-9-7-15(8-10-17)14-20-12-3-2-6-18(20)16-5-4-11-19-13-16/h4-5,7-11,13,18H,2-3,6,12,14H2,1H3/t18-/m0/s1 |
| InChIKey | DQVHMLVFTJQPBH-SFHVURJKSA-N |
| XLogP | 3.82 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |