C17H19ClN2 — CID 872932
3-[(2S)-1-[(3-chlorophenyl)methyl]piperidin-2-yl]pyridine (PubChem CID 872932) has the molecular formula C17H19ClN2 and a molecular weight of 286.81 g/mol. Its IUPAC name is 3-[(2S)-1-[(3-chlorophenyl)methyl]piperidin-2-yl]pyridine.
| Compound Name | 3-[(2S)-1-[(3-chlorophenyl)methyl]piperidin-2-yl]pyridine |
|---|---|
| PubChem CID | 872932 |
| Molecular Formula | C17H19ClN2 |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3-[(2S)-1-[(3-chlorophenyl)methyl]piperidin-2-yl]pyridine |
| SMILES | Clc1cccc(CN2CCCC[C@H]2c2cccnc2)c1 |
| InChI | InChI=1S/C17H19ClN2/c18-16-7-3-5-14(11-16)13-20-10-2-1-8-17(20)15-6-4-9-19-12-15/h3-7,9,11-12,17H,1-2,8,10,13H2/t17-/m0/s1 |
| InChIKey | RUQHUOXKNMHQEF-KRWDZBQOSA-N |
| XLogP | 4.46 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |