C17H18I2N2O — CID 2857406
2,4-diiodo-6-[(2-pyridin-3-ylpiperidin-1-yl)methyl]phenol (PubChem CID 2857406) has the molecular formula C17H18I2N2O and a molecular weight of 520.15 g/mol. Its IUPAC name is 2,4-diiodo-6-[(2-pyridin-3-ylpiperidin-1-yl)methyl]phenol.
| Compound Name | 2,4-diiodo-6-[(2-pyridin-3-ylpiperidin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 2857406 |
| Molecular Formula | C17H18I2N2O |
| Molecular Weight | 520.15 g/mol |
| Exact Mass | 519.95 |
| IUPAC Name | 2,4-diiodo-6-[(2-pyridin-3-ylpiperidin-1-yl)methyl]phenol |
| SMILES | Oc1c(I)cc(I)cc1CN1CCCCC1c1cccnc1 |
| InChI | InChI=1S/C17H18I2N2O/c18-14-8-13(17(22)15(19)9-14)11-21-7-2-1-5-16(21)12-4-3-6-20-10-12/h3-4,6,8-10,16,22H,1-2,5,7,11H2 |
| InChIKey | QWNIRZWIKDTASE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.15 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|