C20H21N3O — CID 99959800
3-phenyl-5-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]-1,2-oxazole (PubChem CID 99959800) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is 3-phenyl-5-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]-1,2-oxazole.
| Compound Name | 3-phenyl-5-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 99959800 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 3-phenyl-5-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]-1,2-oxazole |
| SMILES | c1ccc(-c2cc(CN3CCCC[C@H]3c3cccnc3)on2)cc1 |
| InChI | InChI=1S/C20H21N3O/c1-2-7-16(8-3-1)19-13-18(24-22-19)15-23-12-5-4-10-20(23)17-9-6-11-21-14-17/h1-3,6-9,11,13-14,20H,4-5,10,12,15H2/t20-/m0/s1 |
| InChIKey | PBADSUWMZUVZKR-FQEVSTJZSA-N |
| XLogP | 4.46 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |