C17H18Cl2N2 — CID 40501419
3-[(2R)-1-[(2,3-dichlorophenyl)methyl]piperidin-2-yl]pyridine (PubChem CID 40501419) has the molecular formula C17H18Cl2N2 and a molecular weight of 321.25 g/mol. Its IUPAC name is 3-[(2R)-1-[(2,3-dichlorophenyl)methyl]piperidin-2-yl]pyridine.
| Compound Name | 3-[(2R)-1-[(2,3-dichlorophenyl)methyl]piperidin-2-yl]pyridine |
|---|---|
| PubChem CID | 40501419 |
| Molecular Formula | C17H18Cl2N2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 3-[(2R)-1-[(2,3-dichlorophenyl)methyl]piperidin-2-yl]pyridine |
| SMILES | Clc1cccc(CN2CCCC[C@@H]2c2cccnc2)c1Cl |
| InChI | InChI=1S/C17H18Cl2N2/c18-15-7-3-5-14(17(15)19)12-21-10-2-1-8-16(21)13-6-4-9-20-11-13/h3-7,9,11,16H,1-2,8,10,12H2/t16-/m1/s1 |
| InChIKey | ACIHYVRCJFSJLI-MRXNPFEDSA-N |
| XLogP | 5.12 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |