C20H21FN4 — CID 77085482
3-[1-[[5-(3-fluorophenyl)-1H-pyrazol-4-yl]methyl]piperidin-2-yl]pyridine (PubChem CID 77085482) has the molecular formula C20H21FN4 and a molecular weight of 336.41 g/mol. Its IUPAC name is 3-[1-[[5-(3-fluorophenyl)-1H-pyrazol-4-yl]methyl]piperidin-2-yl]pyridine.
| Compound Name | 3-[1-[[5-(3-fluorophenyl)-1H-pyrazol-4-yl]methyl]piperidin-2-yl]pyridine |
|---|---|
| PubChem CID | 77085482 |
| Molecular Formula | C20H21FN4 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 3-[1-[[5-(3-fluorophenyl)-1H-pyrazol-4-yl]methyl]piperidin-2-yl]pyridine |
| SMILES | Fc1cccc(-c2[nH]ncc2CN2CCCCC2c2cccnc2)c1 |
| InChI | InChI=1S/C20H21FN4/c21-18-7-3-5-15(11-18)20-17(13-23-24-20)14-25-10-2-1-8-19(25)16-6-4-9-22-12-16/h3-7,9,11-13,19H,1-2,8,10,14H2,(H,23,24) |
| InChIKey | ASXDYRAOBPRYAU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |