C18H22FN3 — CID 99928446
3-[[(2S)-2-(3-fluorophenyl)azepan-1-yl]methyl]pyridin-2-amine (PubChem CID 99928446) has the molecular formula C18H22FN3 and a molecular weight of 299.39 g/mol. Its IUPAC name is 3-[[(2S)-2-(3-fluorophenyl)azepan-1-yl]methyl]pyridin-2-amine.
| Compound Name | 3-[[(2S)-2-(3-fluorophenyl)azepan-1-yl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 99928446 |
| Molecular Formula | C18H22FN3 |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 3-[[(2S)-2-(3-fluorophenyl)azepan-1-yl]methyl]pyridin-2-amine |
| SMILES | Nc1ncccc1CN1CCCCC[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C18H22FN3/c19-16-8-4-6-14(12-16)17-9-2-1-3-11-22(17)13-15-7-5-10-21-18(15)20/h4-8,10,12,17H,1-3,9,11,13H2,(H2,20,21)/t17-/m0/s1 |
| InChIKey | AWNUNOMNQZSAMF-KRWDZBQOSA-N |
| XLogP | 3.92 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |