C19H24FN3 — CID 99930686
(2R)-1-[(2-ethylpyrimidin-4-yl)methyl]-2-(3-fluorophenyl)azepane (PubChem CID 99930686) has the molecular formula C19H24FN3 and a molecular weight of 313.42 g/mol. Its IUPAC name is (2R)-1-[(2-ethylpyrimidin-4-yl)methyl]-2-(3-fluorophenyl)azepane.
| Compound Name | (2R)-1-[(2-ethylpyrimidin-4-yl)methyl]-2-(3-fluorophenyl)azepane |
|---|---|
| PubChem CID | 99930686 |
| Molecular Formula | C19H24FN3 |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (2R)-1-[(2-ethylpyrimidin-4-yl)methyl]-2-(3-fluorophenyl)azepane |
| SMILES | CCc1nccc(CN2CCCCC[C@@H]2c2cccc(F)c2)n1 |
| InChI | InChI=1S/C19H24FN3/c1-2-19-21-11-10-17(22-19)14-23-12-5-3-4-9-18(23)15-7-6-8-16(20)13-15/h6-8,10-11,13,18H,2-5,9,12,14H2,1H3/t18-/m1/s1 |
| InChIKey | CXYODYDSQMIUMZ-GOSISDBHSA-N |
| XLogP | 4.30 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |