C15H17FN2S — CID 124754983
2-[[(2S)-2-(3-fluorophenyl)piperidin-1-yl]methyl]-1,3-thiazole (PubChem CID 124754983) has the molecular formula C15H17FN2S and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-[[(2S)-2-(3-fluorophenyl)piperidin-1-yl]methyl]-1,3-thiazole.
| Compound Name | 2-[[(2S)-2-(3-fluorophenyl)piperidin-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 124754983 |
| Molecular Formula | C15H17FN2S |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-[[(2S)-2-(3-fluorophenyl)piperidin-1-yl]methyl]-1,3-thiazole |
| SMILES | Fc1cccc([C@@H]2CCCCN2Cc2nccs2)c1 |
| InChI | InChI=1S/C15H17FN2S/c16-13-5-3-4-12(10-13)14-6-1-2-8-18(14)11-15-17-7-9-19-15/h3-5,7,9-10,14H,1-2,6,8,11H2/t14-/m0/s1 |
| InChIKey | PIGUKCWAQJMCJP-AWEZNQCLSA-N |
| XLogP | 4.01 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |