C15H15BrFNS — CID 20895866
1-[(5-bromothiophen-2-yl)methyl]-2-(3-fluorophenyl)pyrrolidine (PubChem CID 20895866) has the molecular formula C15H15BrFNS and a molecular weight of 340.26 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-2-(3-fluorophenyl)pyrrolidine.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-2-(3-fluorophenyl)pyrrolidine |
|---|---|
| PubChem CID | 20895866 |
| Molecular Formula | C15H15BrFNS |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-2-(3-fluorophenyl)pyrrolidine |
| SMILES | Fc1cccc(C2CCCN2Cc2ccc(Br)s2)c1 |
| InChI | InChI=1S/C15H15BrFNS/c16-15-7-6-13(19-15)10-18-8-2-5-14(18)11-3-1-4-12(17)9-11/h1,3-4,6-7,9,14H,2,5,8,10H2 |
| InChIKey | JFOVTIKUAOSABJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |