C10H14BrNOS — CID 78942538
[(2S)-1-[(5-bromothiophen-2-yl)methyl]pyrrolidin-2-yl]methanol (PubChem CID 78942538) has the molecular formula C10H14BrNOS and a molecular weight of 276.20 g/mol. Its IUPAC name is [(2S)-1-[(5-bromothiophen-2-yl)methyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[(5-bromothiophen-2-yl)methyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 78942538 |
| Molecular Formula | C10H14BrNOS |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | [(2S)-1-[(5-bromothiophen-2-yl)methyl]pyrrolidin-2-yl]methanol |
| SMILES | OC[C@@H]1CCCN1Cc1ccc(Br)s1 |
| InChI | InChI=1S/C10H14BrNOS/c11-10-4-3-9(14-10)6-12-5-1-2-8(12)7-13/h3-4,8,13H,1-2,5-7H2/t8-/m0/s1 |
| InChIKey | WGEMHJWCHNUTMS-QMMMGPOBSA-N |
| XLogP | 2.47 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |