C14H23BrN2OS — CID 111114765
[1-[4-[(5-bromothiophen-2-yl)methylamino]butyl]pyrrolidin-2-yl]methanol (PubChem CID 111114765) has the molecular formula C14H23BrN2OS and a molecular weight of 347.32 g/mol. Its IUPAC name is [1-[4-[(5-bromothiophen-2-yl)methylamino]butyl]pyrrolidin-2-yl]methanol.
| Compound Name | [1-[4-[(5-bromothiophen-2-yl)methylamino]butyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 111114765 |
| Molecular Formula | C14H23BrN2OS |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | [1-[4-[(5-bromothiophen-2-yl)methylamino]butyl]pyrrolidin-2-yl]methanol |
| SMILES | OCC1CCCN1CCCCNCc1ccc(Br)s1 |
| InChI | InChI=1S/C14H23BrN2OS/c15-14-6-5-13(19-14)10-16-7-1-2-8-17-9-3-4-12(17)11-18/h5-6,12,16,18H,1-4,7-11H2 |
| InChIKey | VYZJZCYQHFUNKT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|