C16H24F2N2O — CID 111114718
[1-[4-[(2,5-difluorophenyl)methylamino]butyl]pyrrolidin-2-yl]methanol (PubChem CID 111114718) has the molecular formula C16H24F2N2O and a molecular weight of 298.38 g/mol. Its IUPAC name is [1-[4-[(2,5-difluorophenyl)methylamino]butyl]pyrrolidin-2-yl]methanol.
| Compound Name | [1-[4-[(2,5-difluorophenyl)methylamino]butyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 111114718 |
| Molecular Formula | C16H24F2N2O |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | [1-[4-[(2,5-difluorophenyl)methylamino]butyl]pyrrolidin-2-yl]methanol |
| SMILES | OCC1CCCN1CCCCNCc1cc(F)ccc1F |
| InChI | InChI=1S/C16H24F2N2O/c17-14-5-6-16(18)13(10-14)11-19-7-1-2-8-20-9-3-4-15(20)12-21/h5-6,10,15,19,21H,1-4,7-9,11-12H2 |
| InChIKey | YNDRFCWAVRTDEJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|