C17H26ClN3O2 — CID 95763323
1-[(4-chlorophenyl)methyl]-3-[4-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]butyl]urea (PubChem CID 95763323) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[4-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]butyl]urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[4-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]butyl]urea |
|---|---|
| PubChem CID | 95763323 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[4-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]butyl]urea |
| SMILES | O=C(NCCCCN1CCC[C@@H]1CO)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H26ClN3O2/c18-15-7-5-14(6-8-15)12-20-17(23)19-9-1-2-10-21-11-3-4-16(21)13-22/h5-8,16,22H,1-4,9-13H2,(H2,19,20,23)/t16-/m1/s1 |
| InChIKey | UHTYMKLGEMVCCD-MRXNPFEDSA-N |
| XLogP | 2.38 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|