C14H22N4O4S — CID 172863423
3-[4-[2-(hydroxymethyl)pyrrolidin-1-yl]butylcarbamoylamino]-1,2-thiazole-4-carboxylic acid (PubChem CID 172863423) has the molecular formula C14H22N4O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is 3-[4-[2-(hydroxymethyl)pyrrolidin-1-yl]butylcarbamoylamino]-1,2-thiazole-4-carboxylic acid.
| Compound Name | 3-[4-[2-(hydroxymethyl)pyrrolidin-1-yl]butylcarbamoylamino]-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 172863423 |
| Molecular Formula | C14H22N4O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 3-[4-[2-(hydroxymethyl)pyrrolidin-1-yl]butylcarbamoylamino]-1,2-thiazole-4-carboxylic acid |
| SMILES | O=C(NCCCCN1CCCC1CO)Nc1nscc1C(=O)O |
| InChI | InChI=1S/C14H22N4O4S/c19-8-10-4-3-7-18(10)6-2-1-5-15-14(22)16-12-11(13(20)21)9-23-17-12/h9-10,19H,1-8H2,(H,20,21)(H2,15,16,17,22) |
| InChIKey | ZQXHKEHEMXBTAP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|