C20H27N3O2 — CID 95318276
1-[4-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]butyl]-3-naphthalen-1-ylurea (PubChem CID 95318276) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-[4-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]butyl]-3-naphthalen-1-ylurea.
| Compound Name | 1-[4-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]butyl]-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 95318276 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1-[4-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]butyl]-3-naphthalen-1-ylurea |
| SMILES | O=C(NCCCCN1CCC[C@@H]1CO)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C20H27N3O2/c24-15-17-9-6-14-23(17)13-4-3-12-21-20(25)22-19-11-5-8-16-7-1-2-10-18(16)19/h1-2,5,7-8,10-11,17,24H,3-4,6,9,12-15H2,(H2,21,22,25)/t17-/m1/s1 |
| InChIKey | FNGXKJHBNBDKFM-QGZVFWFLSA-N |
| XLogP | 3.20 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|