C17H30N4O3 — CID 111474555
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-(hydroxymethyl)pyrrolidin-1-yl]butyl]urea (PubChem CID 111474555) has the molecular formula C17H30N4O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-(hydroxymethyl)pyrrolidin-1-yl]butyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-(hydroxymethyl)pyrrolidin-1-yl]butyl]urea |
|---|---|
| PubChem CID | 111474555 |
| Molecular Formula | C17H30N4O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-(hydroxymethyl)pyrrolidin-1-yl]butyl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)NCCCCN2CCCC2CO)no1 |
| InChI | InChI=1S/C17H30N4O3/c1-17(2,3)14-11-15(20-24-14)19-16(23)18-8-4-5-9-21-10-6-7-13(21)12-22/h11,13,22H,4-10,12H2,1-3H3,(H2,18,19,20,23) |
| InChIKey | LMOXYBKUDACASV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|