C17H27BrN4O2 — CID 97060762
5-bromo-2-(dimethylamino)-N-[4-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]butyl]pyridine-3-carboxamide (PubChem CID 97060762) has the molecular formula C17H27BrN4O2 and a molecular weight of 399.33 g/mol. Its IUPAC name is 5-bromo-2-(dimethylamino)-N-[4-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]butyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-(dimethylamino)-N-[4-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]butyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 97060762 |
| Molecular Formula | C17H27BrN4O2 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 5-bromo-2-(dimethylamino)-N-[4-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]butyl]pyridine-3-carboxamide |
| SMILES | CN(C)c1ncc(Br)cc1C(=O)NCCCCN1CCC[C@@H]1CO |
| InChI | InChI=1S/C17H27BrN4O2/c1-21(2)16-15(10-13(18)11-20-16)17(24)19-7-3-4-8-22-9-5-6-14(22)12-23/h10-11,14,23H,3-9,12H2,1-2H3,(H,19,24)/t14-/m1/s1 |
| InChIKey | ALZLRHGRZIDJRE-CQSZACIVSA-N |
| XLogP | 1.88 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|