C17H26FN3O3 — CID 97455332
1-(4-fluoro-3-methoxyphenyl)-3-[3-[(2S)-2-(hydroxymethyl)piperidin-1-yl]propyl]urea (PubChem CID 97455332) has the molecular formula C17H26FN3O3 and a molecular weight of 339.41 g/mol. Its IUPAC name is 1-(4-fluoro-3-methoxyphenyl)-3-[3-[(2S)-2-(hydroxymethyl)piperidin-1-yl]propyl]urea.
| Compound Name | 1-(4-fluoro-3-methoxyphenyl)-3-[3-[(2S)-2-(hydroxymethyl)piperidin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 97455332 |
| Molecular Formula | C17H26FN3O3 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 1-(4-fluoro-3-methoxyphenyl)-3-[3-[(2S)-2-(hydroxymethyl)piperidin-1-yl]propyl]urea |
| SMILES | COc1cc(NC(=O)NCCCN2CCCC[C@H]2CO)ccc1F |
| InChI | InChI=1S/C17H26FN3O3/c1-24-16-11-13(6-7-15(16)18)20-17(23)19-8-4-10-21-9-3-2-5-14(21)12-22/h6-7,11,14,22H,2-5,8-10,12H2,1H3,(H2,19,20,23)/t14-/m0/s1 |
| InChIKey | ZHAURGCYWXPOGZ-AWEZNQCLSA-N |
| XLogP | 2.19 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|