C18H28ClN3OS — CID 133154550
1-(3-chloro-4-methoxyphenyl)-3-[3-(2-ethylpiperidin-1-yl)propyl]thiourea (PubChem CID 133154550) has the molecular formula C18H28ClN3OS and a molecular weight of 369.96 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-[3-(2-ethylpiperidin-1-yl)propyl]thiourea.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-[3-(2-ethylpiperidin-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 133154550 |
| Molecular Formula | C18H28ClN3OS |
| Molecular Weight | 369.96 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-[3-(2-ethylpiperidin-1-yl)propyl]thiourea |
| SMILES | CCC1CCCCN1CCCNC(=S)Nc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C18H28ClN3OS/c1-3-15-7-4-5-11-22(15)12-6-10-20-18(24)21-14-8-9-17(23-2)16(19)13-14/h8-9,13,15H,3-7,10-12H2,1-2H3,(H2,20,21,24) |
| InChIKey | RWZGWUBTTZHENM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.96 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|