C19H31N3S — CID 100685707
1-(3,4-dimethylphenyl)-3-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]thiourea (PubChem CID 100685707) has the molecular formula C19H31N3S and a molecular weight of 333.55 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]thiourea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]thiourea |
|---|---|
| PubChem CID | 100685707 |
| Molecular Formula | C19H31N3S |
| Molecular Weight | 333.55 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]thiourea |
| SMILES | CC[C@H]1CCCCN1CCCNC(=S)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H31N3S/c1-4-18-8-5-6-12-22(18)13-7-11-20-19(23)21-17-10-9-15(2)16(3)14-17/h9-10,14,18H,4-8,11-13H2,1-3H3,(H2,20,21,23)/t18-/m0/s1 |
| InChIKey | SFTDFQJEFCXAMY-SFHVURJKSA-N |
| XLogP | 4.24 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|