C16H25ClN4OS — CID 3593529
1-(3-chloro-4-methoxyphenyl)-3-[3-(4-methylpiperazin-1-yl)propyl]thiourea (PubChem CID 3593529) has the molecular formula C16H25ClN4OS and a molecular weight of 356.92 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-[3-(4-methylpiperazin-1-yl)propyl]thiourea.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-[3-(4-methylpiperazin-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 3593529 |
| Molecular Formula | C16H25ClN4OS |
| Molecular Weight | 356.92 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-[3-(4-methylpiperazin-1-yl)propyl]thiourea |
| SMILES | COc1ccc(NC(=S)NCCCN2CCN(C)CC2)cc1Cl |
| InChI | InChI=1S/C16H25ClN4OS/c1-20-8-10-21(11-9-20)7-3-6-18-16(23)19-13-4-5-15(22-2)14(17)12-13/h4-5,12H,3,6-11H2,1-2H3,(H2,18,19,23) |
| InChIKey | WBOSMISFPCGQMQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.92 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|