C16H24ClN3O3S — CID 8748306
1-(5-chloro-2,4-dimethoxyphenyl)-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 8748306) has the molecular formula C16H24ClN3O3S and a molecular weight of 373.91 g/mol. Its IUPAC name is 1-(5-chloro-2,4-dimethoxyphenyl)-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 8748306 |
| Molecular Formula | C16H24ClN3O3S |
| Molecular Weight | 373.91 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | COc1cc(OC)c(NC(=S)NCCCN2CCOCC2)cc1Cl |
| InChI | InChI=1S/C16H24ClN3O3S/c1-21-14-11-15(22-2)13(10-12(14)17)19-16(24)18-4-3-5-20-6-8-23-9-7-20/h10-11H,3-9H2,1-2H3,(H2,18,19,24) |
| InChIKey | FTLYECIUSPQBSJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 54.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.91 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|