C13H18ClN3O3S — CID 3846042
N-[2-[(4-chloro-2,5-dimethoxyphenyl)carbamothioylamino]ethyl]acetamide (PubChem CID 3846042) has the molecular formula C13H18ClN3O3S and a molecular weight of 331.83 g/mol. Its IUPAC name is N-[2-[(4-chloro-2,5-dimethoxyphenyl)carbamothioylamino]ethyl]acetamide.
| Compound Name | N-[2-[(4-chloro-2,5-dimethoxyphenyl)carbamothioylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 3846042 |
| Molecular Formula | C13H18ClN3O3S |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | N-[2-[(4-chloro-2,5-dimethoxyphenyl)carbamothioylamino]ethyl]acetamide |
| SMILES | COc1cc(NC(=S)NCCNC(C)=O)c(OC)cc1Cl |
| InChI | InChI=1S/C13H18ClN3O3S/c1-8(18)15-4-5-16-13(21)17-10-7-11(19-2)9(14)6-12(10)20-3/h6-7H,4-5H2,1-3H3,(H,15,18)(H2,16,17,21) |
| InChIKey | KVEUSQGMKQPDSE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|