C19H22ClN3O4S — CID 15954879
N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]-2-methoxy-5-methylphenyl]acetamide (PubChem CID 15954879) has the molecular formula C19H22ClN3O4S and a molecular weight of 423.92 g/mol. Its IUPAC name is N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]-2-methoxy-5-methylphenyl]acetamide.
| Compound Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]-2-methoxy-5-methylphenyl]acetamide |
|---|---|
| PubChem CID | 15954879 |
| Molecular Formula | C19H22ClN3O4S |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]-2-methoxy-5-methylphenyl]acetamide |
| SMILES | COc1cc(OC)c(NC(=S)Nc2cc(OC)c(NC(C)=O)cc2C)cc1Cl |
| InChI | InChI=1S/C19H22ClN3O4S/c1-10-6-14(21-11(2)24)17(26-4)8-13(10)22-19(28)23-15-7-12(20)16(25-3)9-18(15)27-5/h6-9H,1-5H3,(H,21,24)(H2,22,23,28) |
| InChIKey | ZSOGDHCRZKRAAB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|