C21H20ClN3O4S — CID 57073332
N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]phenyl]-3-methylfuran-2-carboxamide (PubChem CID 57073332) has the molecular formula C21H20ClN3O4S and a molecular weight of 445.93 g/mol. Its IUPAC name is N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]phenyl]-3-methylfuran-2-carboxamide.
| Compound Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]phenyl]-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 57073332 |
| Molecular Formula | C21H20ClN3O4S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]phenyl]-3-methylfuran-2-carboxamide |
| SMILES | COc1cc(OC)c(NC(=S)Nc2ccc(NC(=O)c3occc3C)cc2)cc1Cl |
| InChI | InChI=1S/C21H20ClN3O4S/c1-12-8-9-29-19(12)20(26)23-13-4-6-14(7-5-13)24-21(30)25-16-10-15(22)17(27-2)11-18(16)28-3/h4-11H,1-3H3,(H,23,26)(H2,24,25,30) |
| InChIKey | IATOYKDYHLHSAA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 84.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|