C23H18ClFN4O3S — CID 15955435
N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]-3-cyanophenyl]-2-fluorobenzamide (PubChem CID 15955435) has the molecular formula C23H18ClFN4O3S and a molecular weight of 484.94 g/mol. Its IUPAC name is N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]-3-cyanophenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]-3-cyanophenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 15955435 |
| Molecular Formula | C23H18ClFN4O3S |
| Molecular Weight | 484.94 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]-3-cyanophenyl]-2-fluorobenzamide |
| SMILES | COc1cc(OC)c(NC(=S)Nc2ccc(NC(=O)c3ccccc3F)cc2C#N)cc1Cl |
| InChI | InChI=1S/C23H18ClFN4O3S/c1-31-20-11-21(32-2)19(10-16(20)24)29-23(33)28-18-8-7-14(9-13(18)12-26)27-22(30)15-5-3-4-6-17(15)25/h3-11H,1-2H3,(H,27,30)(H2,28,29,33) |
| InChIKey | AWCDXSJRQKVAKF-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.94 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|