C21H17FIN3O2S — CID 15955682
2-fluoro-N-[4-[(3-iodo-4-methoxyphenyl)carbamothioylamino]phenyl]benzamide (PubChem CID 15955682) has the molecular formula C21H17FIN3O2S and a molecular weight of 521.36 g/mol. Its IUPAC name is 2-fluoro-N-[4-[(3-iodo-4-methoxyphenyl)carbamothioylamino]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[(3-iodo-4-methoxyphenyl)carbamothioylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 15955682 |
| Molecular Formula | C21H17FIN3O2S |
| Molecular Weight | 521.36 g/mol |
| Exact Mass | 521.01 |
| IUPAC Name | 2-fluoro-N-[4-[(3-iodo-4-methoxyphenyl)carbamothioylamino]phenyl]benzamide |
| SMILES | COc1ccc(NC(=S)Nc2ccc(NC(=O)c3ccccc3F)cc2)cc1I |
| InChI | InChI=1S/C21H17FIN3O2S/c1-28-19-11-10-15(12-18(19)23)26-21(29)25-14-8-6-13(7-9-14)24-20(27)16-4-2-3-5-17(16)22/h2-12H,1H3,(H,24,27)(H2,25,26,29) |
| InChIKey | JSNUDWAEDMKQFV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.36 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|