C23H21ClFN3O3S — CID 10299114
N-[4-[[3-chloro-4-(2-methoxyethoxy)phenyl]carbamothioylamino]phenyl]-2-fluorobenzamide (PubChem CID 10299114) has the molecular formula C23H21ClFN3O3S and a molecular weight of 473.96 g/mol. Its IUPAC name is N-[4-[[3-chloro-4-(2-methoxyethoxy)phenyl]carbamothioylamino]phenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[[3-chloro-4-(2-methoxyethoxy)phenyl]carbamothioylamino]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 10299114 |
| Molecular Formula | C23H21ClFN3O3S |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | N-[4-[[3-chloro-4-(2-methoxyethoxy)phenyl]carbamothioylamino]phenyl]-2-fluorobenzamide |
| SMILES | COCCOc1ccc(NC(=S)Nc2ccc(NC(=O)c3ccccc3F)cc2)cc1Cl |
| InChI | InChI=1S/C23H21ClFN3O3S/c1-30-12-13-31-21-11-10-17(14-19(21)24)28-23(32)27-16-8-6-15(7-9-16)26-22(29)18-4-2-3-5-20(18)25/h2-11,14H,12-13H2,1H3,(H,26,29)(H2,27,28,32) |
| InChIKey | BVTJJCYVXGLXHZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|