C19H20ClFN2O2S — CID 4947158
N-[(3-chloro-4-fluorophenyl)carbamothioyl]-2-pentoxybenzamide (PubChem CID 4947158) has the molecular formula C19H20ClFN2O2S and a molecular weight of 394.90 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)carbamothioyl]-2-pentoxybenzamide.
| Compound Name | N-[(3-chloro-4-fluorophenyl)carbamothioyl]-2-pentoxybenzamide |
|---|---|
| PubChem CID | 4947158 |
| Molecular Formula | C19H20ClFN2O2S |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)carbamothioyl]-2-pentoxybenzamide |
| SMILES | CCCCCOc1ccccc1C(=O)NC(=S)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C19H20ClFN2O2S/c1-2-3-6-11-25-17-8-5-4-7-14(17)18(24)23-19(26)22-13-9-10-16(21)15(20)12-13/h4-5,7-10,12H,2-3,6,11H2,1H3,(H2,22,23,24,26) |
| InChIKey | FIFWHANTHWGNHB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|