C23H20ClFN2O3S — CID 23095269
N-[4-[1-(3-chloro-4-methoxyanilino)-1-oxopropan-2-yl]sulfanylphenyl]-2-fluorobenzamide (PubChem CID 23095269) has the molecular formula C23H20ClFN2O3S and a molecular weight of 458.94 g/mol. Its IUPAC name is N-[4-[1-(3-chloro-4-methoxyanilino)-1-oxopropan-2-yl]sulfanylphenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[1-(3-chloro-4-methoxyanilino)-1-oxopropan-2-yl]sulfanylphenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 23095269 |
| Molecular Formula | C23H20ClFN2O3S |
| Molecular Weight | 458.94 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | N-[4-[1-(3-chloro-4-methoxyanilino)-1-oxopropan-2-yl]sulfanylphenyl]-2-fluorobenzamide |
| SMILES | COc1ccc(NC(=O)C(C)Sc2ccc(NC(=O)c3ccccc3F)cc2)cc1Cl |
| InChI | InChI=1S/C23H20ClFN2O3S/c1-14(22(28)27-16-9-12-21(30-2)19(24)13-16)31-17-10-7-15(8-11-17)26-23(29)18-5-3-4-6-20(18)25/h3-14H,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | XJPFVPTYSTTYQN-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.94 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |