C15H12ClF2NOS — CID 8740662
(2S)-N-(3-chloro-4-fluorophenyl)-2-(4-fluorophenyl)sulfanylpropanamide (PubChem CID 8740662) has the molecular formula C15H12ClF2NOS and a molecular weight of 327.78 g/mol. Its IUPAC name is (2S)-N-(3-chloro-4-fluorophenyl)-2-(4-fluorophenyl)sulfanylpropanamide.
| Compound Name | (2S)-N-(3-chloro-4-fluorophenyl)-2-(4-fluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 8740662 |
| Molecular Formula | C15H12ClF2NOS |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | (2S)-N-(3-chloro-4-fluorophenyl)-2-(4-fluorophenyl)sulfanylpropanamide |
| SMILES | C[C@H](Sc1ccc(F)cc1)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H12ClF2NOS/c1-9(21-12-5-2-10(17)3-6-12)15(20)19-11-4-7-14(18)13(16)8-11/h2-9H,1H3,(H,19,20)/t9-/m0/s1 |
| InChIKey | CXHHJCITKSYYKY-VIFPVBQESA-N |
| XLogP | 4.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |