C15H11F4NOS — CID 24500478
N-(3,4-difluorophenyl)-2-(3,4-difluorophenyl)sulfanylpropanamide (PubChem CID 24500478) has the molecular formula C15H11F4NOS and a molecular weight of 329.32 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-(3,4-difluorophenyl)sulfanylpropanamide.
| Compound Name | N-(3,4-difluorophenyl)-2-(3,4-difluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 24500478 |
| Molecular Formula | C15H11F4NOS |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-(3,4-difluorophenyl)sulfanylpropanamide |
| SMILES | CC(Sc1ccc(F)c(F)c1)C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H11F4NOS/c1-8(22-10-3-5-12(17)14(19)7-10)15(21)20-9-2-4-11(16)13(18)6-9/h2-8H,1H3,(H,20,21) |
| InChIKey | DHEYJUAXKBJWCE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |