C15H11F3N2O3S — CID 55387447
2-(3,4-difluorophenyl)sulfanyl-N-(4-fluoro-3-nitrophenyl)propanamide (PubChem CID 55387447) has the molecular formula C15H11F3N2O3S and a molecular weight of 356.33 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)sulfanyl-N-(4-fluoro-3-nitrophenyl)propanamide.
| Compound Name | 2-(3,4-difluorophenyl)sulfanyl-N-(4-fluoro-3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 55387447 |
| Molecular Formula | C15H11F3N2O3S |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 2-(3,4-difluorophenyl)sulfanyl-N-(4-fluoro-3-nitrophenyl)propanamide |
| SMILES | CC(Sc1ccc(F)c(F)c1)C(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11F3N2O3S/c1-8(24-10-3-5-11(16)13(18)7-10)15(21)19-9-2-4-12(17)14(6-9)20(22)23/h2-8H,1H3,(H,19,21) |
| InChIKey | SEJUJIHWBRCGHR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|