C17H17FN2O3S — CID 7456444
(2S)-2-(3,4-dimethylphenyl)sulfanyl-N-(4-fluoro-3-nitrophenyl)propanamide (PubChem CID 7456444) has the molecular formula C17H17FN2O3S and a molecular weight of 348.40 g/mol. Its IUPAC name is (2S)-2-(3,4-dimethylphenyl)sulfanyl-N-(4-fluoro-3-nitrophenyl)propanamide.
| Compound Name | (2S)-2-(3,4-dimethylphenyl)sulfanyl-N-(4-fluoro-3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 7456444 |
| Molecular Formula | C17H17FN2O3S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (2S)-2-(3,4-dimethylphenyl)sulfanyl-N-(4-fluoro-3-nitrophenyl)propanamide |
| SMILES | Cc1ccc(S[C@@H](C)C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cc1C |
| InChI | InChI=1S/C17H17FN2O3S/c1-10-4-6-14(8-11(10)2)24-12(3)17(21)19-13-5-7-15(18)16(9-13)20(22)23/h4-9,12H,1-3H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | IYADQFIOUWYCTN-LBPRGKRZSA-N |
| XLogP | 4.47 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|