C19H17FN6O4S2 — CID 46575349
2-[[5-(3-acetamidoanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-fluoro-3-nitrophenyl)propanamide (PubChem CID 46575349) has the molecular formula C19H17FN6O4S2 and a molecular weight of 476.52 g/mol. Its IUPAC name is 2-[[5-(3-acetamidoanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-fluoro-3-nitrophenyl)propanamide.
| Compound Name | 2-[[5-(3-acetamidoanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-fluoro-3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 46575349 |
| Molecular Formula | C19H17FN6O4S2 |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 2-[[5-(3-acetamidoanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-fluoro-3-nitrophenyl)propanamide |
| SMILES | CC(=O)Nc1cccc(Nc2nnc(SC(C)C(=O)Nc3ccc(F)c([N+](=O)[O-])c3)s2)c1 |
| InChI | InChI=1S/C19H17FN6O4S2/c1-10(17(28)22-14-6-7-15(20)16(9-14)26(29)30)31-19-25-24-18(32-19)23-13-5-3-4-12(8-13)21-11(2)27/h3-10H,1-2H3,(H,21,27)(H,22,28)(H,23,24) |
| InChIKey | VILSAVIZUVGPCH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|