C16H16FN5O4S2 — CID 55528968
2-[[5-[acetyl(cyclopropyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-fluoro-3-nitrophenyl)propanamide (PubChem CID 55528968) has the molecular formula C16H16FN5O4S2 and a molecular weight of 425.47 g/mol. Its IUPAC name is 2-[[5-[acetyl(cyclopropyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-fluoro-3-nitrophenyl)propanamide.
| Compound Name | 2-[[5-[acetyl(cyclopropyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-fluoro-3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 55528968 |
| Molecular Formula | C16H16FN5O4S2 |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 2-[[5-[acetyl(cyclopropyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-fluoro-3-nitrophenyl)propanamide |
| SMILES | CC(=O)N(c1nnc(SC(C)C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)s1)C1CC1 |
| InChI | InChI=1S/C16H16FN5O4S2/c1-8(14(24)18-10-3-6-12(17)13(7-10)22(25)26)27-16-20-19-15(28-16)21(9(2)23)11-4-5-11/h3,6-8,11H,4-5H2,1-2H3,(H,18,24) |
| InChIKey | ADUABDSDXJXHMA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|