C17H18F2N4O2S2 — CID 18092271
2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,5-difluorophenyl)propanamide (PubChem CID 18092271) has the molecular formula C17H18F2N4O2S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,5-difluorophenyl)propanamide.
| Compound Name | 2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,5-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 18092271 |
| Molecular Formula | C17H18F2N4O2S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,5-difluorophenyl)propanamide |
| SMILES | CCC(=O)N(c1nnc(SC(C)C(=O)Nc2cc(F)ccc2F)s1)C1CC1 |
| InChI | InChI=1S/C17H18F2N4O2S2/c1-3-14(24)23(11-5-6-11)16-21-22-17(27-16)26-9(2)15(25)20-13-8-10(18)4-7-12(13)19/h4,7-9,11H,3,5-6H2,1-2H3,(H,20,25) |
| InChIKey | KZBPGXKVDZEVPS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|